cas: 103549-24-2 — see every product listed under this CAS number, including other names
tert-butyl N-[2-(1H-indol-3-yl)ethyl]carbamate, 95%, 95% (CAS 103549-24-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1196MQ-50mg |
| cas | 103549-24-2 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 342.80 Pln | |
| Chemat | 1g | 2978.00 Pln | |
| Chemat | 250mg | 1043.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[2-(1H-indol-3-yl)ethyl]carbamate (CAS 103549-24-2) is a chemical compound with the molecular formula C15H20N2O2 and a molecular weight of 260.33 g/mol. IUPAC name: tert-butyl N-[2-(1H-indol-3-yl)ethyl]carbamate. InChIKey: UJUWQLXEMKUVGE-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O2 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | tert-butyl N-[2-(1H-indol-3-yl)ethyl]carbamate |
| InChIKey | UJUWQLXEMKUVGE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)