cas: 1416323-32-4 — see every product listed under this CAS number, including other names
tert-butyl N-[3-(3-bromophenyl)oxetan-3-yl]carbamate, 97%, 97% (CAS 1416323-32-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JSZ8-100mg |
| cas | 1416323-32-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1518.80 Pln | |
| Chemat | 250mg | 2392.40 Pln | |
| Chemat | 500mg | 3947.60 Pln | |
| Chemat | 1g | 5882.00 Pln | |
| Chemat | 5g | 17526.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[3-(3-bromophenyl)oxetan-3-yl]carbamate (CAS 1416323-32-4) is a chemical compound with the molecular formula C14H18BrNO3 and a molecular weight of 328.20 g/mol. IUPAC name: tert-butyl N-[3-(3-bromophenyl)oxetan-3-yl]carbamate. InChIKey: SKVXUXJMWRHVQR-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO3 |
|---|---|
| Molecular weight | 328.20 g/mol |
| IUPAC name | tert-butyl N-[3-(3-bromophenyl)oxetan-3-yl]carbamate |
| InChIKey | SKVXUXJMWRHVQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(COC1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)