cas: 1363382-06-2 — see every product listed under this CAS number, including other names
tert-butyl N-{[3-(aminomethyl)cyclobutyl]methyl}carbamate 97% (CAS 1363382-06-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A995853-50mg |
| cas | 1363382-06-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 709.69 Pln | |
| Ambeed | 100mg | 1149.12 Pln | |
| Ambeed | 250mg | 1755.44 Pln | |
| Ambeed | 1g | 4486.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A995853 |
Tert-butyl N-[[3-(aminomethyl)cyclobutyl]methyl]carbamate (CAS 1363382-06-2) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[[3-(aminomethyl)cyclobutyl]methyl]carbamate. InChIKey: IJXVAVJJPSTQHE-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[[3-(aminomethyl)cyclobutyl]methyl]carbamate |
| InChIKey | IJXVAVJJPSTQHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CC(C1)CN |
Computed by PubChem (NCBI)