cas: 14618-59-8 — see every product listed under this CAS number, including other names
tert-butyl p-tolylcarbamate, 98% (CAS 14618-59-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F465733-1G |
| cas | 14618-59-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 940.31 Pln | |
| Fluorochem | 10g | 1825.42 Pln | |
| Fluorochem | 25g | 2762.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-methylphenyl)carbamate (CAS 14618-59-8) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl N-(4-methylphenyl)carbamate. InChIKey: GNUJXPOJGTXSEZ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl N-(4-methylphenyl)carbamate |
| InChIKey | GNUJXPOJGTXSEZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)