cas: 917342-29-1 — see every product listed under this CAS number, including other names
trans 2-{1-[4-(N-(tert-butoxycarbonyl))amino]cyclohexyl}ethanol, 98%, 98% (CAS 917342-29-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H2JN-100mg |
| cas | 917342-29-1 |
| size | 100mg |
| availability | 69g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 515.60 Pln | |
| Chemat | 25g | 1163.60 Pln | |
| Chemat | 50g | 1994.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[4-(2-hydroxyethyl)cyclohexyl]carbamate (CAS 917342-29-1) is a chemical compound with the molecular formula C13H25NO3 and a molecular weight of 243.34 g/mol. IUPAC name: tert-butyl N-[4-(2-hydroxyethyl)cyclohexyl]carbamate. InChIKey: KTNFSGIXLVLQNK-UHFFFAOYSA-N.
| Molecular formula | C13H25NO3 |
|---|---|
| Molecular weight | 243.34 g/mol |
| IUPAC name | tert-butyl N-[4-(2-hydroxyethyl)cyclohexyl]carbamate |
| InChIKey | KTNFSGIXLVLQNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)CCO |
Computed by PubChem (NCBI)