cas: 917342-29-1 — see every product listed under this CAS number, including other names
trans-1-(Boc-amino)-4-(2-hydroxyethyl)cyclohexane 97% (CAS 917342-29-1) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A250414-500g |
| cas | 917342-29-1 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 25546.25 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 2061.38 Pln | |
| Ambeed | 100g | 6439.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A250414 |
Tert-butyl N-[4-(2-hydroxyethyl)cyclohexyl]carbamate (CAS 917342-29-1) is a chemical compound with the molecular formula C13H25NO3 and a molecular weight of 243.34 g/mol. IUPAC name: tert-butyl N-[4-(2-hydroxyethyl)cyclohexyl]carbamate. InChIKey: KTNFSGIXLVLQNK-UHFFFAOYSA-N.
| Molecular formula | C13H25NO3 |
|---|---|
| Molecular weight | 243.34 g/mol |
| IUPAC name | tert-butyl N-[4-(2-hydroxyethyl)cyclohexyl]carbamate |
| InChIKey | KTNFSGIXLVLQNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)CCO |
Computed by PubChem (NCBI)