cas: 31420-66-3 — see every product listed under this CAS number, including other names
trans-2-(Ethoxycarbonyl)cyclopropanecarboxylic acid 97% (CAS 31420-66-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A619964-100mg |
| cas | 31420-66-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 459.38 Pln | |
| Ambeed | 1g | 1032.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A619964 |
Trans-(1R,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid (CAS 31420-66-3) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: trans-(1R,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: BRVQFDJETHFEQY-RFZPGFLSSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | trans-(1R,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | BRVQFDJETHFEQY-RFZPGFLSSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C(=O)O |
Computed by PubChem (NCBI)