cas: 939400-34-7 — see every product listed under this CAS number, including other names
trans-3-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid, 97%, 97% (CAS 939400-34-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GRDV-500g |
| cas | 939400-34-7 |
| size | 500g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 22075.20 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 472.40 Pln | |
| Chemat | 10g | 789.20 Pln | |
| Chemat | 25g | 1413.20 Pln | |
| Chemat | 50g | 2709.20 Pln | |
| Chemat | 100g | 4768.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 939400-34-7) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: KLCYDBAYYYVNFM-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | KLCYDBAYYYVNFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(C1)C(=O)O |
Computed by PubChem (NCBI)