CAS 939400-34-7 appears in our catalog under these names: trans-3-(Boc-amino)cyclobutanecarboxylic acid, 97% , trans-3-(tert-butoxycarbonylamino)cyclobutanecarboxylic acid 98%, trans-3-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid, 97%, 97%, trans-3-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid, 98.0%, trans-3-((tert-Butoxycarbonyl)amino)cyclobutanecarboxylic acid, 97%. Offered by: Thermo Scientific (Alfa Aesar), Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 500g, 100mg, 250mg, 5g, 25g, 100g, 10g.
3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 939400-34-7) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: KLCYDBAYYYVNFM-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | KLCYDBAYYYVNFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(C1)C(=O)O |
Computed by PubChem (NCBI)