cas: 1408075-44-4 — see every product listed under this CAS number, including other names
trans-3-((tert-Butyldimethylsilyl)oxy)cyclobutanol, 95%, 95% (CAS 1408075-44-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CTY-25g |
| cas | 1408075-44-4 |
| size | 25g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 18630.80 Pln | |
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 602.00 Pln | |
| Chemat | 1g | 1370.00 Pln | |
| Chemat | 5g | 5723.60 Pln | |
| Chemat | 10g | 10274.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[tert-butyl(dimethyl)silyl]oxycyclobutan-1-ol (CAS 1408075-44-4) is a chemical compound with the molecular formula C10H22O2Si and a molecular weight of 202.37 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxycyclobutan-1-ol. InChIKey: ILGIKHCMCDNBSK-UHFFFAOYSA-N.
| Molecular formula | C10H22O2Si |
|---|---|
| Molecular weight | 202.37 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxycyclobutan-1-ol |
| InChIKey | ILGIKHCMCDNBSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(C1)O |
Computed by PubChem (NCBI)