CAS 1408075-44-4 appears in our catalog under these names: Trans-3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]cyclobutanol, 95%, trans-3-((tert-Butyldimethylsilyl)oxy)cyclobutanol, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g.
3-[tert-butyl(dimethyl)silyl]oxycyclobutan-1-ol (CAS 1408075-44-4) is a chemical compound with the molecular formula C10H22O2Si and a molecular weight of 202.37 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxycyclobutan-1-ol. InChIKey: ILGIKHCMCDNBSK-UHFFFAOYSA-N.
| Molecular formula | C10H22O2Si |
|---|---|
| Molecular weight | 202.37 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxycyclobutan-1-ol |
| InChIKey | ILGIKHCMCDNBSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(C1)O |
Computed by PubChem (NCBI)