cas: 1110650-68-4 — see every product listed under this CAS number, including other names
trans-3-Oxabicyclo(3.1.0)hexane-6-acetic acid, 95+% (CAS 1110650-68-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A507827-5g |
| cas | 1110650-68-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 25263.70 Pln | |
| AmBeed | 1g | 14815.15 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]acetic acid (CAS 1110650-68-4) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: 2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]acetic acid. InChIKey: UYSCSVKDPCUZBY-GOHHTPAQSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | 2-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]acetic acid |
| InChIKey | UYSCSVKDPCUZBY-GOHHTPAQSA-N |
| SMILES | C1[C@@H]2[C@@H](C2CC(=O)O)CO1 |
Computed by PubChem (NCBI)