Products 937053-06-0

CAS 937053-06-0 is the registry number for Rac-(1r,2r,4s)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

(1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 937053-06-0) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: UYLYISCHTFVYHN-KVQBGUIXSA-N.

Identity
Molecular formulaC7H10O3
Molecular weight142.15 g/mol
IUPAC name(1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid
InChIKeyUYLYISCHTFVYHN-KVQBGUIXSA-N
SMILESC1C[C@@H]2[C@@H](C[C@H]1O2)C(=O)O

Computed by PubChem (NCBI)