cas: 62439-33-2 — see every product listed under this CAS number, including other names
trans-4-Cyanophenyl 4-propylcyclohexanecarboxylate 97% (CAS 62439-33-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A657813-1g |
| cas | 62439-33-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 381.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A657813 |
(4-cyanophenyl) 4-propylcyclohexane-1-carboxylate (CAS 62439-33-2) is a chemical compound with the molecular formula C17H21NO2 and a molecular weight of 271.35 g/mol. IUPAC name: (4-cyanophenyl) 4-propylcyclohexane-1-carboxylate. InChIKey: LXVTVIQMKOLVSY-UHFFFAOYSA-N.
| Molecular formula | C17H21NO2 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | (4-cyanophenyl) 4-propylcyclohexane-1-carboxylate |
| InChIKey | LXVTVIQMKOLVSY-UHFFFAOYSA-N |
| SMILES | CCCC1CCC(CC1)C(=O)OC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)