cas: 869193-57-7 — see every product listed under this CAS number, including other names
trans-4-hydroxycyclohexanecarboxylic acid tert-butyl ester, 98%, 98% (CAS 869193-57-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JU15-50mg |
| cas | 869193-57-7 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 131.60 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 2406.80 Pln | |
| Chemat | 10g | 3784.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-hydroxycyclohexane-1-carboxylate (CAS 869193-57-7) is a chemical compound with the molecular formula C11H20O3 and a molecular weight of 200.27 g/mol. IUPAC name: tert-butyl 4-hydroxycyclohexane-1-carboxylate. InChIKey: MVSANBPTBLEQMT-UHFFFAOYSA-N.
| Molecular formula | C11H20O3 |
|---|---|
| Molecular weight | 200.27 g/mol |
| IUPAC name | tert-butyl 4-hydroxycyclohexane-1-carboxylate |
| InChIKey | MVSANBPTBLEQMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCC(CC1)O |
Computed by PubChem (NCBI)