cas: 519188-72-8 — see every product listed under this CAS number, including other names
trans-Pyrrolidine-3,4-diol hydrochloride, 97% (CAS 519188-72-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A681114-10g |
| cas | 519188-72-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8214.01 Pln | |
| AmBeed | 25g | 11853.10 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S,4S)-pyrrolidine-3,4-diol;hydrochloride (CAS 519188-72-8) is a chemical compound with the molecular formula C4H10ClNO2 and a molecular weight of 139.58 g/mol. IUPAC name: (3S,4S)-pyrrolidine-3,4-diol;hydrochloride. InChIKey: VADWFRGDDJHKNB-MMALYQPHSA-N.
| Molecular formula | C4H10ClNO2 |
|---|---|
| Molecular weight | 139.58 g/mol |
| IUPAC name | (3S,4S)-pyrrolidine-3,4-diol;hydrochloride |
| InChIKey | VADWFRGDDJHKNB-MMALYQPHSA-N |
| SMILES | C1[C@@H]([C@H](CN1)O)O.Cl |
Computed by PubChem (NCBI)