cas: 138026-89-8 — see every product listed under this CAS number, including other names
trans-tert-Butyl 3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate, 97%, 97% (CAS 138026-89-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128V7-100mg |
| cas | 138026-89-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 179.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate (CAS 138026-89-8) is a chemical compound with the molecular formula C16H24N2O3 and a molecular weight of 292.37 g/mol. IUPAC name: tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate. InChIKey: GVYATPKTSSTHKN-ZIAGYGMSSA-N.
| Molecular formula | C16H24N2O3 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | GVYATPKTSSTHKN-ZIAGYGMSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)