cas: 74786-02-0 — see every product listed under this CAS number, including other names
((1-(tert-Butoxy)vinyl)oxy)(tert-butyl)dimethylsilane 97% mix TBC as stabilizer (CAS 74786-02-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156396-250mg |
| cas | 74786-02-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 826.50 Pln | |
| Ambeed | 10g | 1366.06 Pln | |
| Ambeed | 25g | 2361.75 Pln | |
| Ambeed | 100g | 7412.50 Pln |
| purity | 97% mix TBC as stabilizer |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156396 |
Tert-butyl-dimethyl-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]silane (CAS 74786-02-0) is a chemical compound with the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. IUPAC name: tert-butyl-dimethyl-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]silane. InChIKey: YSGPQBUGNZSBGY-UHFFFAOYSA-N.
| Molecular formula | C12H26O2Si |
|---|---|
| Molecular weight | 230.42 g/mol |
| IUPAC name | tert-butyl-dimethyl-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]silane |
| InChIKey | YSGPQBUGNZSBGY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=C)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)