CAS 220343-46-4 is the registry number for (1-(((tert-Butyldimethylsilyl)oxy)methyl)cyclobutyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
[1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclobutyl]methanol (CAS 220343-46-4) is a chemical compound with the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. IUPAC name: [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclobutyl]methanol. InChIKey: AONWRCHOMRHIOU-UHFFFAOYSA-N.
| Molecular formula | C12H26O2Si |
|---|---|
| Molecular weight | 230.42 g/mol |
| IUPAC name | [1-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclobutyl]methanol |
| InChIKey | AONWRCHOMRHIOU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(CCC1)CO |
Computed by PubChem (NCBI)