cas: 74786-02-0 — see every product listed under this CAS number, including other names
[[1-(1,1-Dimethylethoxy)ethenyl]oxy](1,1-dimethylethyl)dimethylsilane, 95%+, 95%+ (CAS 74786-02-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119OZP-250mg |
| cas | 74786-02-0 |
| size | 250mg |
| availability | 29.55g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1096.40 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Tert-butyl-dimethyl-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]silane (CAS 74786-02-0) is a chemical compound with the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. IUPAC name: tert-butyl-dimethyl-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]silane. InChIKey: YSGPQBUGNZSBGY-UHFFFAOYSA-N.
| Molecular formula | C12H26O2Si |
|---|---|
| Molecular weight | 230.42 g/mol |
| IUPAC name | tert-butyl-dimethyl-[1-[(2-methylpropan-2-yl)oxy]ethenoxy]silane |
| InChIKey | YSGPQBUGNZSBGY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=C)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)