cas: 1009793-82-1 — see every product listed under this CAS number, including other names
((2,5-dimethylphenyl)sulfonyl)leucine, 96% (CAS 1009793-82-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F512253-250MG |
| cas | 1009793-82-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 500mg | 221.81 Pln | |
| Fluorochem | 100mg | 91.65 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-[(2,5-dimethylphenyl)sulfonylamino]-4-methylpentanoic acid (CAS 1009793-82-1) is a chemical compound with the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. IUPAC name: 2-[(2,5-dimethylphenyl)sulfonylamino]-4-methylpentanoic acid. InChIKey: YKLYILQBCOVJHM-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4S |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | 2-[(2,5-dimethylphenyl)sulfonylamino]-4-methylpentanoic acid |
| InChIKey | YKLYILQBCOVJHM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NC(CC(C)C)C(=O)O |
Computed by PubChem (NCBI)