CAS 1858251-98-5 is the registry number for Methyl 4-[(2,5-dimethylphenyl)(methylsulfonyl)amino]butanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-(2,5-dimethyl-N-methylsulfonylanilino)butanoate (CAS 1858251-98-5) is a chemical compound with the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. IUPAC name: methyl 4-(2,5-dimethyl-N-methylsulfonylanilino)butanoate. InChIKey: OOGAYOCADOMDRY-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4S |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | methyl 4-(2,5-dimethyl-N-methylsulfonylanilino)butanoate |
| InChIKey | OOGAYOCADOMDRY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)N(CCCC(=O)OC)S(=O)(=O)C |
Computed by PubChem (NCBI)