CAS 733044-79-6 appears in our catalog under these names: 4-(2,3,5,6-Tetramethyl-benzenesulfonylamino)-butyric acid, 95%, 4-(2,3,5,6-Tetramethylbenzenesulfonamido)butanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid (CAS 733044-79-6) is a chemical compound with the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. IUPAC name: 4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid. InChIKey: VUMSWKCPJSILTE-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4S |
|---|---|
| Molecular weight | 299.39 g/mol |
| IUPAC name | 4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid |
| InChIKey | VUMSWKCPJSILTE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NCCCC(=O)O)C)C |
Computed by PubChem (NCBI)