CAS 2407907-33-7 appears in our catalog under these names: ((2S,5S)–5–Methylpiperazin–2–yl)methanol dihydrochloride, ((2S,5S)-5-methylpiperazin-2-yl)methanol dihydrochloride, 95%, 95%, ((2S,5S)-5-Methylpiperazin-2-yl)methanol dihydrochloride, 97%, ((2S,5S)-5-Methylpiperazin-2-yl)methanol dihydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg.
[(2S,5S)-5-methylpiperazin-2-yl]methanol;dihydrochloride (CAS 2407907-33-7) is a chemical compound with the molecular formula C6H16Cl2N2O and a molecular weight of 203.11 g/mol. IUPAC name: [(2S,5S)-5-methylpiperazin-2-yl]methanol;dihydrochloride. InChIKey: KWUUEQADUUJHKU-USPAICOZSA-N.
| Molecular formula | C6H16Cl2N2O |
|---|---|
| Molecular weight | 203.11 g/mol |
| IUPAC name | [(2S,5S)-5-methylpiperazin-2-yl]methanol;dihydrochloride |
| InChIKey | KWUUEQADUUJHKU-USPAICOZSA-N |
| SMILES | C[C@H]1CN[C@@H](CN1)CO.Cl.Cl |
Computed by PubChem (NCBI)