CAS 2349395-67-9 appears in our catalog under these names: ((2R,5R)-5-Methylpiperazin-2-yl)methanol dihydrochloride, 97%, 97%, ((2R,5R)-5-Methylpiperazin-2-yl)methanol dihydrochloride, 95%, ((2R,5R)-5-Methylpiperazin-2-yl)methanol dihydrochloride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[(2R,5R)-5-methylpiperazin-2-yl]methanol;dihydrochloride (CAS 2349395-67-9) is a chemical compound with the molecular formula C6H16Cl2N2O and a molecular weight of 203.11 g/mol. IUPAC name: [(2R,5R)-5-methylpiperazin-2-yl]methanol;dihydrochloride. InChIKey: KWUUEQADUUJHKU-BNTLRKBRSA-N.
| Molecular formula | C6H16Cl2N2O |
|---|---|
| Molecular weight | 203.11 g/mol |
| IUPAC name | [(2R,5R)-5-methylpiperazin-2-yl]methanol;dihydrochloride |
| InChIKey | KWUUEQADUUJHKU-BNTLRKBRSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1)CO.Cl.Cl |
Computed by PubChem (NCBI)