cas: 73346-74-4 — see every product listed under this CAS number, including other names
((4R,5R)-2,2-Dimethyl-1,3-dioxolane-4,5-diyl)dimethanol 95% (CAS 73346-74-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A305617-1g |
| cas | 73346-74-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1510.69 Pln | |
| Ambeed | 10g | 2217.12 Pln | |
| Ambeed | 25g | 3919.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A305617 |
[(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (CAS 73346-74-4) is a chemical compound with the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. IUPAC name: [(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol. InChIKey: INVRLGIKFANLFP-PHDIDXHHSA-N.
| Molecular formula | C7H14O4 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | [(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| InChIKey | INVRLGIKFANLFP-PHDIDXHHSA-N |
| SMILES | CC1(O[C@@H]([C@H](O1)CO)CO)C |
Computed by PubChem (NCBI)