cas: 73346-74-4 — see every product listed under this CAS number, including other names
((4R,5R)-2,2-Dimethyl-1,3-dioxolane-4,5-diyl)dimethanol, 95%, 95% (CAS 73346-74-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BB7-1g |
| cas | 73346-74-4 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1182.80 Pln | |
| Chemat | 10g | 1763.60 Pln | |
| Chemat | 25g | 3131.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (CAS 73346-74-4) is a chemical compound with the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. IUPAC name: [(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol. InChIKey: INVRLGIKFANLFP-PHDIDXHHSA-N.
| Molecular formula | C7H14O4 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | [(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| InChIKey | INVRLGIKFANLFP-PHDIDXHHSA-N |
| SMILES | CC1(O[C@@H]([C@H](O1)CO)CO)C |
Computed by PubChem (NCBI)