CAS 75772-01-9 appears in our catalog under these names: TRIPHENYLBENZYLOXYMETHYLPHOSPHONIUM CHL&, ((Benzyloxy)methyl)triphenylphosphonium chloride, 97%, 97%, ((Benzyloxy)methyl)triphenylphosphonium chloride, 97%. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5G, 100mg, 250mg, 1g, 10g, 25g.
Triphenyl(phenylmethoxymethyl)phosphanium chloride (CAS 75772-01-9) is a chemical compound with the molecular formula C26H24ClOP and a molecular weight of 418.9 g/mol. IUPAC name: triphenyl(phenylmethoxymethyl)phosphanium chloride. InChIKey: GJPGLLAXZTYTFW-UHFFFAOYSA-M.
| Molecular formula | C26H24ClOP |
|---|---|
| Molecular weight | 418.9 g/mol |
| IUPAC name | triphenyl(phenylmethoxymethyl)phosphanium chloride |
| InChIKey | GJPGLLAXZTYTFW-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)COC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)