Products 75772-01-9

CAS 75772-01-9 appears in our catalog under these names: TRIPHENYLBENZYLOXYMETHYLPHOSPHONIUM CHL&, ((Benzyloxy)methyl)triphenylphosphonium chloride, 97%, 97%, ((Benzyloxy)methyl)triphenylphosphonium chloride, 97%. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5G, 100mg, 250mg, 1g, 10g, 25g.

Structural formula: {0} (CAS {1})

Triphenyl(phenylmethoxymethyl)phosphanium chloride (CAS 75772-01-9) is a chemical compound with the molecular formula C26H24ClOP and a molecular weight of 418.9 g/mol. IUPAC name: triphenyl(phenylmethoxymethyl)phosphanium chloride. InChIKey: GJPGLLAXZTYTFW-UHFFFAOYSA-M.

Identity
Molecular formulaC26H24ClOP
Molecular weight418.9 g/mol
IUPAC nametriphenyl(phenylmethoxymethyl)phosphanium chloride
InChIKeyGJPGLLAXZTYTFW-UHFFFAOYSA-M
SMILESC1=CC=C(C=C1)COC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]

Computed by PubChem (NCBI)