CAS 52045-25-7 appears in our catalog under these names: (2-Methoxybenzyl)triphenylphosphonium chloride, 95-<97%, (2-Methoxybenzyl)triphenylphosphonium Chloride. Offered by: Hoffman Fine Chemicals, TRC. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 100mg.
(2-methoxyphenyl)methyl-triphenylphosphanium chloride (CAS 52045-25-7) is a chemical compound with the molecular formula C26H24ClOP and a molecular weight of 418.9 g/mol. IUPAC name: (2-methoxyphenyl)methyl-triphenylphosphanium chloride. InChIKey: TZRCYVSSZNAXEW-UHFFFAOYSA-M.
| Molecular formula | C26H24ClOP |
|---|---|
| Molecular weight | 418.9 g/mol |
| IUPAC name | (2-methoxyphenyl)methyl-triphenylphosphanium chloride |
| InChIKey | TZRCYVSSZNAXEW-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC=C1C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)