Products 18880-05-2

CAS 18880-05-2 appears in our catalog under these names: (3-Methoxybenzyl)(triphenyl)phosphonium Chloride, (3–Methoxybenzyl)triphenylphosphonium Chloride, (3-Methoxybenzyl)triphenylphosphonium Chloride, >98.0%(HPLC)(T), (3-Methoxybenzyl)triphenylphosphonium chloride 95%, 3-Methoxybenzyltriphenylphosphonium chloride, 95%, 95%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 50mg, 25g, 1g, 5g, 250mg, 10g, 100g.

Structural formula: {0} (CAS {1})

(3-methoxyphenyl)methyl-triphenylphosphanium chloride (CAS 18880-05-2) is a chemical compound with the molecular formula C26H24ClOP and a molecular weight of 418.9 g/mol. IUPAC name: (3-methoxyphenyl)methyl-triphenylphosphanium chloride. InChIKey: DPYDLIVUYPUXBV-UHFFFAOYSA-M.

Identity
Molecular formulaC26H24ClOP
Molecular weight418.9 g/mol
IUPAC name(3-methoxyphenyl)methyl-triphenylphosphanium chloride
InChIKeyDPYDLIVUYPUXBV-UHFFFAOYSA-M
SMILESCOC1=CC=CC(=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]

Computed by PubChem (NCBI)