CAS 18880-05-2 appears in our catalog under these names: (3-Methoxybenzyl)(triphenyl)phosphonium Chloride, (3–Methoxybenzyl)triphenylphosphonium Chloride, (3-Methoxybenzyl)triphenylphosphonium Chloride, >98.0%(HPLC)(T), (3-Methoxybenzyl)triphenylphosphonium chloride 95%, 3-Methoxybenzyltriphenylphosphonium chloride, 95%, 95%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 50mg, 25g, 1g, 5g, 250mg, 10g, 100g.
(3-methoxyphenyl)methyl-triphenylphosphanium chloride (CAS 18880-05-2) is a chemical compound with the molecular formula C26H24ClOP and a molecular weight of 418.9 g/mol. IUPAC name: (3-methoxyphenyl)methyl-triphenylphosphanium chloride. InChIKey: DPYDLIVUYPUXBV-UHFFFAOYSA-M.
| Molecular formula | C26H24ClOP |
|---|---|
| Molecular weight | 418.9 g/mol |
| IUPAC name | (3-methoxyphenyl)methyl-triphenylphosphanium chloride |
| InChIKey | DPYDLIVUYPUXBV-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC(=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)