CAS 98327-87-8 appears in our catalog under these names: Brexpiprazole Impurity 36, 2,2'-Bis(diphenylphosphino)-1,1'-dinaphthalene, >95% (HPLC), 2,2′–Bis(diphenylphosphino)–1,1′–binaphthalene, (+/-)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl, 97+% , (±)-BINAP. Offered by: Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: on request, 100g, 25g, 5g, 0,025kg, 0,05kg, 1g, 0,1kg.
[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane (CAS 98327-87-8) is a chemical compound with the molecular formula C44H32P2 and a molecular weight of 622.7 g/mol. IUPAC name: [1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane. InChIKey: MUALRAIOVNYAIW-UHFFFAOYSA-N.
| Molecular formula | C44H32P2 |
|---|---|
| Molecular weight | 622.7 g/mol |
| IUPAC name | [1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane |
| InChIKey | MUALRAIOVNYAIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)