cas: 43119-28-4 — see every product listed under this CAS number, including other names
(−)-G-Lactone, 98.0% (CAS 43119-28-4) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g, 10 g, 250 mg, 500 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-43001-5 g |
| cas | 43119-28-4 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 2469.86 Pln | |
| MedChemExpress | 1 g | 904.84 Pln | |
| MedChemExpress | 10 g | 4034.89 Pln | |
| MedChemExpress | 250 mg | 407.93 Pln | |
| MedChemExpress | 500 mg | 612.26 Pln | |
| MedChemExpress | 100 mg | 263.96 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(3aR,6aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one (CAS 43119-28-4) is a chemical compound with the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. IUPAC name: (3aR,6aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one. InChIKey: RYBPGUMSFWGGLP-WDSKDSINSA-N.
| Molecular formula | C7H8O2 |
|---|---|
| Molecular weight | 124.14 g/mol |
| IUPAC name | (3aR,6aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one |
| InChIKey | RYBPGUMSFWGGLP-WDSKDSINSA-N |
| SMILES | C1C=C[C@@H]2[C@H]1OC(=O)C2 |
Computed by PubChem (NCBI)