cas: 43119-28-4 — see every product listed under this CAS number, including other names
(3aR,6aS)-3,3a,6,6a-Tetrahydro-2H-cyclopenta[b]furan-2-one, 98%, 98% (CAS 43119-28-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDTZ-100mg |
| cas | 43119-28-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 1331.60 Pln | |
| Chemat | 10g | 2224.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3aR,6aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one (CAS 43119-28-4) is a chemical compound with the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. IUPAC name: (3aR,6aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one. InChIKey: RYBPGUMSFWGGLP-WDSKDSINSA-N.
| Molecular formula | C7H8O2 |
|---|---|
| Molecular weight | 124.14 g/mol |
| IUPAC name | (3aR,6aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one |
| InChIKey | RYBPGUMSFWGGLP-WDSKDSINSA-N |
| SMILES | C1C=C[C@@H]2[C@H]1OC(=O)C2 |
Computed by PubChem (NCBI)