cas: 117384-46-0 — see every product listed under this CAS number, including other names
(-)-Di-Tert-Butyl D-Tartrate, 98%, 98% (CAS 117384-46-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111E7U-100mg |
| cas | 117384-46-0 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 659.60 Pln | |
| Chemat | 250mg | 1058.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl (2S,3S)-2,3-dihydroxybutanedioate (CAS 117384-46-0) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: ditert-butyl (2S,3S)-2,3-dihydroxybutanedioate. InChIKey: ITWOKJQQGHCDBL-YUMQZZPRSA-N.
| Molecular formula | C12H22O6 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | ditert-butyl (2S,3S)-2,3-dihydroxybutanedioate |
| InChIKey | ITWOKJQQGHCDBL-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]([C@@H](C(=O)OC(C)(C)C)O)O |
Computed by PubChem (NCBI)