CAS 87-92-3 appears in our catalog under these names: L-(+)-Tartaric acid di-n-butyl ester, 95%, Dibutyl L–(+)–Tartrate, Dibutyl L-(+)-Tartrate, >98.0%(GC), L-(+)-Tartaric acid dibutyl ester, 98%+(GC-MS),RG, 98%+(GC-MS),RG, (2R,3R)-Dibutyl 2,3-dihydroxysuccinate, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 500g.
Dibutyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 87-92-3) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: dibutyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: PCYQQSKDZQTOQG-NXEZZACHSA-N.
| Molecular formula | C12H22O6 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | dibutyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | PCYQQSKDZQTOQG-NXEZZACHSA-N |
| SMILES | CCCCOC(=O)[C@@H]([C@H](C(=O)OCCCC)O)O |
Computed by PubChem (NCBI)