CAS 4054-82-4 is the registry number for Diisobutyl 2,3-dihydroxysuccinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
Bis(2-methylpropyl) (2R,3R)-2,3-dihydroxybutanedioate (CAS 4054-82-4) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: bis(2-methylpropyl) (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: ONZOGXRINCURBP-NXEZZACHSA-N.
| Molecular formula | C12H22O6 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | bis(2-methylpropyl) (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | ONZOGXRINCURBP-NXEZZACHSA-N |
| SMILES | CC(C)COC(=O)[C@@H]([C@H](C(=O)OCC(C)C)O)O |
Computed by PubChem (NCBI)