Products 4054-82-4

CAS 4054-82-4 is the registry number for Diisobutyl 2,3-dihydroxysuccinate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

Bis(2-methylpropyl) (2R,3R)-2,3-dihydroxybutanedioate (CAS 4054-82-4) is a chemical compound with the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. IUPAC name: bis(2-methylpropyl) (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: ONZOGXRINCURBP-NXEZZACHSA-N.

Identity
Molecular formulaC12H22O6
Molecular weight262.30 g/mol
IUPAC namebis(2-methylpropyl) (2R,3R)-2,3-dihydroxybutanedioate
InChIKeyONZOGXRINCURBP-NXEZZACHSA-N
SMILESCC(C)COC(=O)[C@@H]([C@H](C(=O)OCC(C)C)O)O

Computed by PubChem (NCBI)