cas: 4375-07-9 — see every product listed under this CAS number, including other names
(-)-Epipodophyllotoxin 99% (CAS 4375-07-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1144810-1mg |
| cas | 4375-07-9 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 220.19 Pln | |
| Ambeed | 5mg | 481.62 Pln | |
| Ambeed | 10mg | 693.00 Pln | |
| Ambeed | 50mg | 2139.25 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1144810 |
(5S,5aR,8aR,9R)-5-hydroxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one (CAS 4375-07-9) is a chemical compound with the molecular formula C22H22O8 and a molecular weight of 414.4 g/mol. IUPAC name: (5S,5aR,8aR,9R)-5-hydroxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one. InChIKey: YJGVMLPVUAXIQN-LGWHJFRWSA-N.
| Molecular formula | C22H22O8 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | (5S,5aR,8aR,9R)-5-hydroxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| InChIKey | YJGVMLPVUAXIQN-LGWHJFRWSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@@H]3[C@H](COC3=O)[C@@H](C4=CC5=C(C=C24)OCO5)O |
Computed by PubChem (NCBI)