CAS 1773494-04-4 is the registry number for 1,4-dimethyl (2S,3S)-2,3-bis[(4-methylphenyl)carbonyloxy]butanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Dimethyl (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioate (CAS 1773494-04-4) is a chemical compound with the molecular formula C22H22O8 and a molecular weight of 414.4 g/mol. IUPAC name: dimethyl (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioate. InChIKey: BZAGONFTBOBTQG-ROUUACIJSA-N.
| Molecular formula | C22H22O8 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | dimethyl (2S,3S)-2,3-bis[(4-methylbenzoyl)oxy]butanedioate |
| InChIKey | BZAGONFTBOBTQG-ROUUACIJSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@@H]([C@@H](C(=O)OC)OC(=O)C2=CC=C(C=C2)C)C(=O)OC |
Computed by PubChem (NCBI)