cas: 105400-81-5 — see every product listed under this CAS number, including other names
(1,2,3,4-Tetrahydro-isoquinolin-1-yl)-acetic acid, 95+%, 95+% (CAS 105400-81-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118EOR-100mg |
| cas | 105400-81-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 1g | 1480.40 Pln | |
| Chemat | 5g | 4077.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-(1,2,3,4-tetrahydroisoquinolin-1-yl)acetic acid (CAS 105400-81-5) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 2-(1,2,3,4-tetrahydroisoquinolin-1-yl)acetic acid. InChIKey: BUAVPRGEIAVFBF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 2-(1,2,3,4-tetrahydroisoquinolin-1-yl)acetic acid |
| InChIKey | BUAVPRGEIAVFBF-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=CC=CC=C21)CC(=O)O |
Computed by PubChem (NCBI)