Products 592479-02-2
CAS 592479-02-2 is the registry number for 1-(2,2-Dimethoxy-ethyl)-2-isocyano-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2,2-dimethoxyethyl)-2-isocyanobenzene (CAS 592479-02-2) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 1-(2,2-dimethoxyethyl)-2-isocyanobenzene. InChIKey: XSTAOBURMHGXDG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 1-(2,2-dimethoxyethyl)-2-isocyanobenzene |
| InChIKey | XSTAOBURMHGXDG-UHFFFAOYSA-N |
| SMILES | COC(CC1=CC=CC=C1[N+]#[C-])OC |
Computed by PubChem (NCBI)