cas: 1234615-95-2 — see every product listed under this CAS number, including other names
(1,2,4)Triazolo(4,3-a)pyridine-5-carboxylic acid, 97% (CAS 1234615-95-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A746338-10g |
| cas | 1234615-95-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8669.71 Pln | |
| AmBeed | 5g | 7178.92 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
[1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid (CAS 1234615-95-2) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: [1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid. InChIKey: OEIZLOMSYUPULT-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | [1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid |
| InChIKey | OEIZLOMSYUPULT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=CN2C(=C1)C(=O)O |
Computed by PubChem (NCBI)