cas: 1234615-95-2 — see every product listed under this CAS number, including other names
[1,2,4]Triazolo[4,3-a]pyridine-5-carboxylic acid, 95%, 95% (CAS 1234615-95-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111KLN-100mg |
| cas | 1234615-95-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 500mg | 563.60 Pln | |
| Chemat | 1g | 626.00 Pln | |
| Chemat | 5g | 1874.00 Pln | |
| Chemat | 10g | 3592.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid (CAS 1234615-95-2) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: [1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid. InChIKey: OEIZLOMSYUPULT-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | [1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid |
| InChIKey | OEIZLOMSYUPULT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=CN2C(=C1)C(=O)O |
Computed by PubChem (NCBI)