cas: 1234615-95-2 — see every product listed under this CAS number, including other names
[1,2,4]Triazolo[4,3-a]pyridine-5-carboxylic acid, 95% (CAS 1234615-95-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QE-0025-5g |
| cas | 1234615-95-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1289.15 Pln | |
| Fluorochem | 5g | 4501.56 Pln | |
| Fluorochem | 10g | 7448.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
[1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid (CAS 1234615-95-2) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: [1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid. InChIKey: OEIZLOMSYUPULT-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | [1,2,4]triazolo[4,3-a]pyridine-5-carboxylic acid |
| InChIKey | OEIZLOMSYUPULT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=CN2C(=C1)C(=O)O |
Computed by PubChem (NCBI)