cas: 1235439-82-3 — see every product listed under this CAS number, including other names
(1,3-Dihydroisobenzofuran-5-yl)methanamine hydrochloride, 95+% (CAS 1235439-82-3) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A974770-5g |
| cas | 1235439-82-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 28928.83 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride (CAS 1235439-82-3) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride. InChIKey: JDRYRWYXGCKYNS-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride |
| InChIKey | JDRYRWYXGCKYNS-UHFFFAOYSA-N |
| SMILES | C1C2=C(CO1)C=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)