Products 19997-54-7

CAS 19997-54-7 appears in our catalog under these names: (2,3-Dihydrobenzofuran-2-yl)methanamine hydrochloride, 95%, (2,3-Dihydrobenzofuran-2-yl)methanamine hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g, 10g.

Structural formula: {0} (CAS {1})

2,3-dihydro-1-benzofuran-2-ylmethanamine;hydrochloride (CAS 19997-54-7) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-2-ylmethanamine;hydrochloride. InChIKey: VLQHTBMTNLHCAE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNO
Molecular weight185.65 g/mol
IUPAC name2,3-dihydro-1-benzofuran-2-ylmethanamine;hydrochloride
InChIKeyVLQHTBMTNLHCAE-UHFFFAOYSA-N
SMILESC1C(OC2=CC=CC=C21)CN.Cl

Computed by PubChem (NCBI)