cas: 1256358-55-0 — see every product listed under this CAS number, including other names
(1-(Phenylsulfonyl)-1H-indol-4-yl)boronic acid 95% (CAS 1256358-55-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A206534-250mg |
| cas | 1256358-55-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1432.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A206534 |
[1-(benzenesulfonyl)indol-4-yl]boronic acid (CAS 1256358-55-0) is a chemical compound with the molecular formula C14H12BNO4S and a molecular weight of 301.1 g/mol. IUPAC name: [1-(benzenesulfonyl)indol-4-yl]boronic acid. InChIKey: KBLZYWJFKKTOPJ-UHFFFAOYSA-N.
| Molecular formula | C14H12BNO4S |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | [1-(benzenesulfonyl)indol-4-yl]boronic acid |
| InChIKey | KBLZYWJFKKTOPJ-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN(C2=CC=C1)S(=O)(=O)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)