Products 480438-51-5

CAS 480438-51-5 appears in our catalog under these names: 1-Phenylsulfonylindole-5-boronic acid, 95%, 1-Phenylsulfonylindole-5-boronic acid, 95%, 95%, (1-(Phenylsulfonyl)-1H-indol-5-yl)boronic acid 95%. Offered by: Combi-blocks, Fluorochem, Chemat, Ambeed. Available pack sizes: 5g, 1g, 250mg, 25g.

Structural formula: {0} (CAS {1})

[1-(benzenesulfonyl)indol-5-yl]boronic acid (CAS 480438-51-5) is a chemical compound with the molecular formula C14H12BNO4S and a molecular weight of 301.1 g/mol. IUPAC name: [1-(benzenesulfonyl)indol-5-yl]boronic acid. InChIKey: QBWYPMYEBNWOFW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12BNO4S
Molecular weight301.1 g/mol
IUPAC name[1-(benzenesulfonyl)indol-5-yl]boronic acid
InChIKeyQBWYPMYEBNWOFW-UHFFFAOYSA-N
SMILESB(C1=CC2=C(C=C1)N(C=C2)S(=O)(=O)C3=CC=CC=C3)(O)O

Computed by PubChem (NCBI)