CAS 1256358-55-0 appears in our catalog under these names: 1-Benzenesulfonyl-1h-indole-4-boronic acid, 97%, (1-(Phenylsulfonyl)-1H-indol-4-yl)boronic acid 95%, (1-(Phenylsulfonyl)-1H-indol-4-yl)boronic acid, 95%, 95%, (1-(Phenylsulfonyl)-1H-indol-4-yl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
[1-(benzenesulfonyl)indol-4-yl]boronic acid (CAS 1256358-55-0) is a chemical compound with the molecular formula C14H12BNO4S and a molecular weight of 301.1 g/mol. IUPAC name: [1-(benzenesulfonyl)indol-4-yl]boronic acid. InChIKey: KBLZYWJFKKTOPJ-UHFFFAOYSA-N.
| Molecular formula | C14H12BNO4S |
|---|---|
| Molecular weight | 301.1 g/mol |
| IUPAC name | [1-(benzenesulfonyl)indol-4-yl]boronic acid |
| InChIKey | KBLZYWJFKKTOPJ-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN(C2=CC=C1)S(=O)(=O)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)