cas: 1260150-04-6 — see every product listed under this CAS number, including other names
(1-(tert-Butoxycarbonyl)-1,2,3,4-tetrahydroquinolin-6-yl)boronic acid, 98% (CAS 1260150-04-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212685-250MG |
| cas | 1260150-04-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 1950.37 Pln | |
| Fluorochem | 10g | 3845.54 Pln | |
| Fluorochem | 25g | 9510.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-quinolin-6-yl]boronic acid (CAS 1260150-04-6) is a chemical compound with the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-quinolin-6-yl]boronic acid. InChIKey: WCXMMFHVJAIPBW-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO4 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-2H-quinolin-6-yl]boronic acid |
| InChIKey | WCXMMFHVJAIPBW-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(CCC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)