CAS 2033056-80-1 is the registry number for 3-Methoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2033056-80-1) is a chemical compound with the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. IUPAC name: 3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: KLHBWKPOCQQEOI-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO4 |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | 3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | KLHBWKPOCQQEOI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)N)OC |
Computed by PubChem (NCBI)